C18H17ClN4O5S — CID 135317035
[7-[(2R,3R,4S,5R)-5-[(R)-(4-chlorophenyl)-hydroxymethyl]-3,4-dihydroxyoxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-yl]carbamothioic S-acid (PubChem CID 135317035) has the molecular formula C18H17ClN4O5S and a molecular weight of 436.88 g/mol. Its IUPAC name is [7-[(2R,3R,4S,5R)-5-[(R)-(4-chlorophenyl)-hydroxymethyl]-3,4-dihydroxyoxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-yl]carbamothioic S-acid.
| Compound Name | [7-[(2R,3R,4S,5R)-5-[(R)-(4-chlorophenyl)-hydroxymethyl]-3,4-dihydroxyoxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-yl]carbamothioic S-acid |
|---|---|
| PubChem CID | 135317035 |
| Molecular Formula | C18H17ClN4O5S |
| Molecular Weight | 436.88 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | [7-[(2R,3R,4S,5R)-5-[(R)-(4-chlorophenyl)-hydroxymethyl]-3,4-dihydroxyoxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-yl]carbamothioic S-acid |
| SMILES | O=C(S)Nc1ncnc2c1ccn2[C@@H]1O[C@H]([C@H](O)c2ccc(Cl)cc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H17ClN4O5S/c19-9-3-1-8(2-4-9)11(24)14-12(25)13(26)17(28-14)23-6-5-10-15(22-18(27)29)20-7-21-16(10)23/h1-7,11-14,17,24-26H,(H2,20,21,22,27,29)/t11-,12+,13-,14-,17-/m1/s1 |
| InChIKey | CNNPSJKUGMXUFP-QFRSUPTLSA-N |
| XLogP | 1.90 |
| TPSA | 129.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.88 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|