C17H17ClN6O5 — CID 135318277
[1-[(2R,3R,4S,5R)-5-[(R)-(4-chlorophenyl)-hydroxymethyl]-3,4-dihydroxyoxolan-2-yl]pyrazolo[3,4-d]pyrimidin-4-yl]urea (PubChem CID 135318277) has the molecular formula C17H17ClN6O5 and a molecular weight of 420.81 g/mol. Its IUPAC name is [1-[(2R,3R,4S,5R)-5-[(R)-(4-chlorophenyl)-hydroxymethyl]-3,4-dihydroxyoxolan-2-yl]pyrazolo[3,4-d]pyrimidin-4-yl]urea.
| Compound Name | [1-[(2R,3R,4S,5R)-5-[(R)-(4-chlorophenyl)-hydroxymethyl]-3,4-dihydroxyoxolan-2-yl]pyrazolo[3,4-d]pyrimidin-4-yl]urea |
|---|---|
| PubChem CID | 135318277 |
| Molecular Formula | C17H17ClN6O5 |
| Molecular Weight | 420.81 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | [1-[(2R,3R,4S,5R)-5-[(R)-(4-chlorophenyl)-hydroxymethyl]-3,4-dihydroxyoxolan-2-yl]pyrazolo[3,4-d]pyrimidin-4-yl]urea |
| SMILES | NC(=O)Nc1ncnc2c1cnn2[C@@H]1O[C@H]([C@H](O)c2ccc(Cl)cc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H17ClN6O5/c18-8-3-1-7(2-4-8)10(25)13-11(26)12(27)16(29-13)24-15-9(5-22-24)14(20-6-21-15)23-17(19)28/h1-6,10-13,16,25-27H,(H3,19,20,21,23,28)/t10-,11+,12-,13-,16-/m1/s1 |
| InChIKey | URUHSKJHFDGNTP-ZUSNOYAUSA-N |
| XLogP | 0.32 |
| TPSA | 168.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.81 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |