C19H21ClN6O4 — CID 142419547
1-[1-[(1R,2S,3R,4R)-4-[(4-chlorophenyl)-hydroxymethyl]-2,3-dihydroxycyclopentyl]pyrazolo[3,4-d]pyrimidin-4-yl]-3-methylurea (PubChem CID 142419547) has the molecular formula C19H21ClN6O4 and a molecular weight of 432.87 g/mol. Its IUPAC name is 1-[1-[(1R,2S,3R,4R)-4-[(4-chlorophenyl)-hydroxymethyl]-2,3-dihydroxycyclopentyl]pyrazolo[3,4-d]pyrimidin-4-yl]-3-methylurea.
| Compound Name | 1-[1-[(1R,2S,3R,4R)-4-[(4-chlorophenyl)-hydroxymethyl]-2,3-dihydroxycyclopentyl]pyrazolo[3,4-d]pyrimidin-4-yl]-3-methylurea |
|---|---|
| PubChem CID | 142419547 |
| Molecular Formula | C19H21ClN6O4 |
| Molecular Weight | 432.87 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 1-[1-[(1R,2S,3R,4R)-4-[(4-chlorophenyl)-hydroxymethyl]-2,3-dihydroxycyclopentyl]pyrazolo[3,4-d]pyrimidin-4-yl]-3-methylurea |
| SMILES | CNC(=O)Nc1ncnc2c1cnn2[C@@H]1C[C@H](C(O)c2ccc(Cl)cc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H21ClN6O4/c1-21-19(30)25-17-12-7-24-26(18(12)23-8-22-17)13-6-11(15(28)16(13)29)14(27)9-2-4-10(20)5-3-9/h2-5,7-8,11,13-16,27-29H,6H2,1H3,(H2,21,22,23,25,30)/t11-,13-,14?,15-,16+/m1/s1 |
| InChIKey | SXIQVAUMTAYKLF-UYVDRTLJSA-N |
| XLogP | 1.25 |
| TPSA | 145.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.87 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |