C19H21Cl3N4O4 — CID 155169774
(1S,2R,3R,5R)-3-[(3,4-dichlorophenyl)-hydroxymethyl]-5-[4-(methoxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentane-1,2-diol;hydrochloride (PubChem CID 155169774) has the molecular formula C19H21Cl3N4O4 and a molecular weight of 475.76 g/mol. Its IUPAC name is (1S,2R,3R,5R)-3-[(3,4-dichlorophenyl)-hydroxymethyl]-5-[4-(methoxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentane-1,2-diol;hydrochloride.
| Compound Name | (1S,2R,3R,5R)-3-[(3,4-dichlorophenyl)-hydroxymethyl]-5-[4-(methoxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentane-1,2-diol;hydrochloride |
|---|---|
| PubChem CID | 155169774 |
| Molecular Formula | C19H21Cl3N4O4 |
| Molecular Weight | 475.76 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | (1S,2R,3R,5R)-3-[(3,4-dichlorophenyl)-hydroxymethyl]-5-[4-(methoxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentane-1,2-diol;hydrochloride |
| SMILES | CONc1ncnc2c1ccn2[C@@H]1C[C@H](C(O)c2ccc(Cl)c(Cl)c2)[C@@H](O)[C@H]1O.Cl |
| InChI | InChI=1S/C19H20Cl2N4O4.ClH/c1-29-24-18-10-4-5-25(19(10)23-8-22-18)14-7-11(16(27)17(14)28)15(26)9-2-3-12(20)13(21)6-9;/h2-6,8,11,14-17,26-28H,7H2,1H3,(H,22,23,24);1H/t11-,14-,15?,16-,17+;/m1./s1 |
| InChIKey | NLFMYJWKFNQZCA-FEUCPZAXSA-N |
| XLogP | 3.15 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.76 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|