C23H25ClN6O3 — CID 154029241
(1S,2R,3S,5R)-3-[2-(2-amino-3-chloroquinolin-7-yl)ethyl]-5-[4-(methoxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentane-1,2-diol (PubChem CID 154029241) has the molecular formula C23H25ClN6O3 and a molecular weight of 468.95 g/mol. Its IUPAC name is (1S,2R,3S,5R)-3-[2-(2-amino-3-chloroquinolin-7-yl)ethyl]-5-[4-(methoxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentane-1,2-diol.
| Compound Name | (1S,2R,3S,5R)-3-[2-(2-amino-3-chloroquinolin-7-yl)ethyl]-5-[4-(methoxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 154029241 |
| Molecular Formula | C23H25ClN6O3 |
| Molecular Weight | 468.95 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | (1S,2R,3S,5R)-3-[2-(2-amino-3-chloroquinolin-7-yl)ethyl]-5-[4-(methoxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentane-1,2-diol |
| SMILES | CONc1ncnc2c1ccn2[C@@H]1C[C@H](CCc2ccc3cc(Cl)c(N)nc3c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C23H25ClN6O3/c1-33-29-22-15-6-7-30(23(15)27-11-26-22)18-10-14(19(31)20(18)32)5-3-12-2-4-13-9-16(24)21(25)28-17(13)8-12/h2,4,6-9,11,14,18-20,31-32H,3,5,10H2,1H3,(H2,25,28)(H,26,27,29)/t14-,18+,19+,20-/m0/s1 |
| InChIKey | IFXCLMGNYHEINP-PSAKCFHXSA-N |
| XLogP | 3.10 |
| TPSA | 131.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.95 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|