C25H27F3N6O2 — CID 126637294
(1R,2S,3R,5S)-3-[4-(methylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-5-[2-[2-(2,2,2-trifluoroethylamino)quinolin-7-yl]ethyl]cyclopentane-1,2-diol (PubChem CID 126637294) has the molecular formula C25H27F3N6O2 and a molecular weight of 500.53 g/mol. Its IUPAC name is (1R,2S,3R,5S)-3-[4-(methylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-5-[2-[2-(2,2,2-trifluoroethylamino)quinolin-7-yl]ethyl]cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5S)-3-[4-(methylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-5-[2-[2-(2,2,2-trifluoroethylamino)quinolin-7-yl]ethyl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 126637294 |
| Molecular Formula | C25H27F3N6O2 |
| Molecular Weight | 500.53 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | (1R,2S,3R,5S)-3-[4-(methylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-5-[2-[2-(2,2,2-trifluoroethylamino)quinolin-7-yl]ethyl]cyclopentane-1,2-diol |
| SMILES | CNc1ncnc2c1ccn2[C@@H]1C[C@H](CCc2ccc3ccc(NCC(F)(F)F)nc3c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C25H27F3N6O2/c1-29-23-17-8-9-34(24(17)32-13-31-23)19-11-16(21(35)22(19)36)5-3-14-2-4-15-6-7-20(33-18(15)10-14)30-12-25(26,27)28/h2,4,6-10,13,16,19,21-22,35-36H,3,5,11-12H2,1H3,(H,30,33)(H,29,31,32)/t16-,19+,21+,22-/m0/s1 |
| InChIKey | GXKVYNJDTGXWNG-MQYXYMALSA-N |
| XLogP | 3.91 |
| TPSA | 108.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.53 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |