C25H24F3N5O4 — CID 126637382
N-[7-[2-[(1S,3S,4R)-2,3-dihydroxy-4-(4-methoxypyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]ethyl]quinolin-2-yl]-2,2,2-trifluoroacetamide (PubChem CID 126637382) has the molecular formula C25H24F3N5O4 and a molecular weight of 515.49 g/mol. Its IUPAC name is N-[7-[2-[(1S,3S,4R)-2,3-dihydroxy-4-(4-methoxypyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]ethyl]quinolin-2-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[7-[2-[(1S,3S,4R)-2,3-dihydroxy-4-(4-methoxypyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]ethyl]quinolin-2-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 126637382 |
| Molecular Formula | C25H24F3N5O4 |
| Molecular Weight | 515.49 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | N-[7-[2-[(1S,3S,4R)-2,3-dihydroxy-4-(4-methoxypyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]ethyl]quinolin-2-yl]-2,2,2-trifluoroacetamide |
| SMILES | COc1ncnc2c1ccn2[C@@H]1C[C@H](CCc2ccc3ccc(NC(=O)C(F)(F)F)nc3c2)C(O)[C@H]1O |
| InChI | InChI=1S/C25H24F3N5O4/c1-37-23-16-8-9-33(22(16)29-12-30-23)18-11-15(20(34)21(18)35)5-3-13-2-4-14-6-7-19(31-17(14)10-13)32-24(36)25(26,27)28/h2,4,6-10,12,15,18,20-21,34-35H,3,5,11H2,1H3,(H,31,32,36)/t15-,18+,20?,21-/m0/s1 |
| InChIKey | UQWKVQQMXMFGJC-BURFLANTSA-N |
| XLogP | 3.40 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |