C26H31ClN6O2 — CID 162314311
(1R,2S,3R,5S)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[2-[2-(cyclopropylmethylamino)quinolin-7-yl]ethyl]cyclopentane-1,2-diol;hydrochloride (PubChem CID 162314311) has the molecular formula C26H31ClN6O2 and a molecular weight of 495.03 g/mol. Its IUPAC name is (1R,2S,3R,5S)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[2-[2-(cyclopropylmethylamino)quinolin-7-yl]ethyl]cyclopentane-1,2-diol;hydrochloride.
| Compound Name | (1R,2S,3R,5S)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[2-[2-(cyclopropylmethylamino)quinolin-7-yl]ethyl]cyclopentane-1,2-diol;hydrochloride |
|---|---|
| PubChem CID | 162314311 |
| Molecular Formula | C26H31ClN6O2 |
| Molecular Weight | 495.03 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | (1R,2S,3R,5S)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[2-[2-(cyclopropylmethylamino)quinolin-7-yl]ethyl]cyclopentane-1,2-diol;hydrochloride |
| SMILES | Cl.Nc1ncnc2c1ccn2[C@@H]1C[C@H](CCc2ccc3ccc(NCC4CC4)nc3c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C26H30N6O2.ClH/c27-25-19-9-10-32(26(19)30-14-29-25)21-12-18(23(33)24(21)34)6-4-15-3-5-17-7-8-22(31-20(17)11-15)28-13-16-1-2-16;/h3,5,7-11,14,16,18,21,23-24,33-34H,1-2,4,6,12-13H2,(H,28,31)(H2,27,29,30);1H/t18-,21+,23+,24-;/m0./s1 |
| InChIKey | VLWVYGVRSUROPC-FULMEXNQSA-N |
| XLogP | 3.72 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.03 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |