C26H30N6O2 — CID 126638109
(1S,2R,3S,5R)-3-[2-[2-(cyclopropylamino)quinolin-7-yl]ethyl]-5-[4-(methylamino)pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentane-1,2-diol (PubChem CID 126638109) has the molecular formula C26H30N6O2 and a molecular weight of 458.57 g/mol. Its IUPAC name is (1S,2R,3S,5R)-3-[2-[2-(cyclopropylamino)quinolin-7-yl]ethyl]-5-[4-(methylamino)pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentane-1,2-diol.
| Compound Name | (1S,2R,3S,5R)-3-[2-[2-(cyclopropylamino)quinolin-7-yl]ethyl]-5-[4-(methylamino)pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 126638109 |
| Molecular Formula | C26H30N6O2 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | (1S,2R,3S,5R)-3-[2-[2-(cyclopropylamino)quinolin-7-yl]ethyl]-5-[4-(methylamino)pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentane-1,2-diol |
| SMILES | CNc1ncnc2c1ccn2[C@@H]1C[C@H](CCc2ccc3ccc(NC4CC4)nc3c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C26H30N6O2/c1-27-25-19-10-11-32(26(19)29-14-28-25)21-13-17(23(33)24(21)34)5-3-15-2-4-16-6-9-22(30-18-7-8-18)31-20(16)12-15/h2,4,6,9-12,14,17-18,21,23-24,33-34H,3,5,7-8,13H2,1H3,(H,30,31)(H,27,28,29)/t17-,21+,23+,24-/m0/s1 |
| InChIKey | SDGMICQZYIIBML-UMWDTMKUSA-N |
| XLogP | 3.51 |
| TPSA | 108.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |