C29H36N6O2 — CID 166630828
(1R,2S,3R,5S)-3-(4-amino-5-cyclohexylpyrrolo[2,3-d]pyrimidin-7-yl)-5-[2-[2-(methylamino)quinolin-7-yl]ethyl]cyclopentane-1,2-diol (PubChem CID 166630828) has the molecular formula C29H36N6O2 and a molecular weight of 500.65 g/mol. Its IUPAC name is (1R,2S,3R,5S)-3-(4-amino-5-cyclohexylpyrrolo[2,3-d]pyrimidin-7-yl)-5-[2-[2-(methylamino)quinolin-7-yl]ethyl]cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5S)-3-(4-amino-5-cyclohexylpyrrolo[2,3-d]pyrimidin-7-yl)-5-[2-[2-(methylamino)quinolin-7-yl]ethyl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 166630828 |
| Molecular Formula | C29H36N6O2 |
| Molecular Weight | 500.65 g/mol |
| Exact Mass | 500.29 |
| IUPAC Name | (1R,2S,3R,5S)-3-(4-amino-5-cyclohexylpyrrolo[2,3-d]pyrimidin-7-yl)-5-[2-[2-(methylamino)quinolin-7-yl]ethyl]cyclopentane-1,2-diol |
| SMILES | CNc1ccc2ccc(CC[C@H]3C[C@@H](n4cc(C5CCCCC5)c5c(N)ncnc54)[C@H](O)[C@@H]3O)cc2n1 |
| InChI | InChI=1S/C29H36N6O2/c1-31-24-12-11-19-9-7-17(13-22(19)34-24)8-10-20-14-23(27(37)26(20)36)35-15-21(18-5-3-2-4-6-18)25-28(30)32-16-33-29(25)35/h7,9,11-13,15-16,18,20,23,26-27,36-37H,2-6,8,10,14H2,1H3,(H,31,34)(H2,30,32,33)/t20-,23+,26+,27-/m0/s1 |
| InChIKey | BSIYUYVHXBWCGF-CYDBCKOSSA-N |
| XLogP | 4.57 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.65 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |