C25H27N5O2 — CID 164951867
(1R,2S,3R,5S)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[2-(2,3-dihydro-1H-cyclopenta[b]quinolin-6-yl)ethyl]cyclopentane-1,2-diol (PubChem CID 164951867) has the molecular formula C25H27N5O2 and a molecular weight of 429.52 g/mol. Its IUPAC name is (1R,2S,3R,5S)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[2-(2,3-dihydro-1H-cyclopenta[b]quinolin-6-yl)ethyl]cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5S)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[2-(2,3-dihydro-1H-cyclopenta[b]quinolin-6-yl)ethyl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 164951867 |
| Molecular Formula | C25H27N5O2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | (1R,2S,3R,5S)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[2-(2,3-dihydro-1H-cyclopenta[b]quinolin-6-yl)ethyl]cyclopentane-1,2-diol |
| SMILES | Nc1ncnc2c1ccn2[C@@H]1C[C@H](CCc2ccc3cc4c(nc3c2)CCC4)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C25H27N5O2/c26-24-18-8-9-30(25(18)28-13-27-24)21-12-17(22(31)23(21)32)7-5-14-4-6-16-11-15-2-1-3-19(15)29-20(16)10-14/h4,6,8-11,13,17,21-23,31-32H,1-3,5,7,12H2,(H2,26,27,28)/t17-,21+,22+,23-/m0/s1 |
| InChIKey | KDKQJIJCGDBGMY-VAFVZNMKSA-N |
| XLogP | 2.97 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |