C26H28ClN5O2 — CID 157343251
(1S,2R,3S,5R)-3-[2-(2-amino-3-chloroquinolin-7-yl)ethyl]-5-[4-(cyclopropylmethyl)pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentane-1,2-diol (PubChem CID 157343251) has the molecular formula C26H28ClN5O2 and a molecular weight of 478.00 g/mol. Its IUPAC name is (1S,2R,3S,5R)-3-[2-(2-amino-3-chloroquinolin-7-yl)ethyl]-5-[4-(cyclopropylmethyl)pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentane-1,2-diol.
| Compound Name | (1S,2R,3S,5R)-3-[2-(2-amino-3-chloroquinolin-7-yl)ethyl]-5-[4-(cyclopropylmethyl)pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 157343251 |
| Molecular Formula | C26H28ClN5O2 |
| Molecular Weight | 478.00 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | (1S,2R,3S,5R)-3-[2-(2-amino-3-chloroquinolin-7-yl)ethyl]-5-[4-(cyclopropylmethyl)pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentane-1,2-diol |
| SMILES | Nc1nc2cc(CC[C@H]3C[C@@H](n4ccc5c(CC6CC6)ncnc54)[C@H](O)[C@@H]3O)ccc2cc1Cl |
| InChI | InChI=1S/C26H28ClN5O2/c27-19-11-16-5-3-15(9-20(16)31-25(19)28)4-6-17-12-22(24(34)23(17)33)32-8-7-18-21(10-14-1-2-14)29-13-30-26(18)32/h3,5,7-9,11,13-14,17,22-24,33-34H,1-2,4,6,10,12H2,(H2,28,31)/t17-,22+,23+,24-/m0/s1 |
| InChIKey | BGQORXMIWROQCV-YABBVRICSA-N |
| XLogP | 4.08 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.00 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |