C25H27N5O4 — CID 149312482
N-[7-[2-[(1S,2R,3S,4R)-2,3-dihydroxy-4-(4-methoxypyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]ethyl]quinolin-2-yl]acetamide (PubChem CID 149312482) has the molecular formula C25H27N5O4 and a molecular weight of 461.52 g/mol. Its IUPAC name is N-[7-[2-[(1S,2R,3S,4R)-2,3-dihydroxy-4-(4-methoxypyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]ethyl]quinolin-2-yl]acetamide.
| Compound Name | N-[7-[2-[(1S,2R,3S,4R)-2,3-dihydroxy-4-(4-methoxypyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]ethyl]quinolin-2-yl]acetamide |
|---|---|
| PubChem CID | 149312482 |
| Molecular Formula | C25H27N5O4 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | N-[7-[2-[(1S,2R,3S,4R)-2,3-dihydroxy-4-(4-methoxypyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]ethyl]quinolin-2-yl]acetamide |
| SMILES | COc1ncnc2c1ccn2[C@@H]1C[C@H](CCc2ccc3ccc(NC(C)=O)nc3c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C25H27N5O4/c1-14(31)28-21-8-7-16-5-3-15(11-19(16)29-21)4-6-17-12-20(23(33)22(17)32)30-10-9-18-24(30)26-13-27-25(18)34-2/h3,5,7-11,13,17,20,22-23,32-33H,4,6,12H2,1-2H3,(H,28,29,31)/t17-,20+,22+,23-/m0/s1 |
| InChIKey | XYWORCXUADMJMQ-ZECSIRQKSA-N |
| XLogP | 2.86 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |