C27H31ClF3N5O2 — CID 145263868
7-[2-[3-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]ethyl]-N-(2,2,2-trifluoroethyl)quinolin-2-amine;propane-2,2-diol (PubChem CID 145263868) has the molecular formula C27H31ClF3N5O2 and a molecular weight of 550.03 g/mol. Its IUPAC name is 7-[2-[3-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]ethyl]-N-(2,2,2-trifluoroethyl)quinolin-2-amine;propane-2,2-diol.
| Compound Name | 7-[2-[3-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]ethyl]-N-(2,2,2-trifluoroethyl)quinolin-2-amine;propane-2,2-diol |
|---|---|
| PubChem CID | 145263868 |
| Molecular Formula | C27H31ClF3N5O2 |
| Molecular Weight | 550.03 g/mol |
| Exact Mass | 549.21 |
| IUPAC Name | 7-[2-[3-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]ethyl]-N-(2,2,2-trifluoroethyl)quinolin-2-amine;propane-2,2-diol |
| SMILES | CC(C)(O)O.FC(F)(F)CNc1ccc2ccc(CCC3CCC(n4ccc5c(Cl)ncnc54)C3)cc2n1 |
| InChI | InChI=1S/C24H23ClF3N5.C3H8O2/c25-22-19-9-10-33(23(19)31-14-30-22)18-7-4-15(11-18)1-2-16-3-5-17-6-8-21(32-20(17)12-16)29-13-24(26,27)28;1-3(2,4)5/h3,5-6,8-10,12,14-15,18H,1-2,4,7,11,13H2,(H,29,32);4-5H,1-2H3 |
| InChIKey | YGPVGCSNPXEMKF-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.03 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|