C18H30ClN3O2 — CID 155705514
4-chloro-7-(3-ethylcyclopentyl)pyrrolo[2,3-d]pyrimidine;ethane;propane-2,2-diol (PubChem CID 155705514) has the molecular formula C18H30ClN3O2 and a molecular weight of 355.91 g/mol. Its IUPAC name is 4-chloro-7-(3-ethylcyclopentyl)pyrrolo[2,3-d]pyrimidine;ethane;propane-2,2-diol.
| Compound Name | 4-chloro-7-(3-ethylcyclopentyl)pyrrolo[2,3-d]pyrimidine;ethane;propane-2,2-diol |
|---|---|
| PubChem CID | 155705514 |
| Molecular Formula | C18H30ClN3O2 |
| Molecular Weight | 355.91 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 4-chloro-7-(3-ethylcyclopentyl)pyrrolo[2,3-d]pyrimidine;ethane;propane-2,2-diol |
| SMILES | CC.CC(C)(O)O.CCC1CCC(n2ccc3c(Cl)ncnc32)C1 |
| InChI | InChI=1S/C13H16ClN3.C3H8O2.C2H6/c1-2-9-3-4-10(7-9)17-6-5-11-12(14)15-8-16-13(11)17;1-3(2,4)5;1-2/h5-6,8-10H,2-4,7H2,1H3;4-5H,1-2H3;1-2H3 |
| InChIKey | LLMCTPCHQAPUNJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.91 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|