C18H28N4O2 — CID 142318317
7-(3-but-3-enylcyclopentyl)pyrrolo[2,3-d]pyrimidin-4-amine;propane-2,2-diol (PubChem CID 142318317) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 7-(3-but-3-enylcyclopentyl)pyrrolo[2,3-d]pyrimidin-4-amine;propane-2,2-diol.
| Compound Name | 7-(3-but-3-enylcyclopentyl)pyrrolo[2,3-d]pyrimidin-4-amine;propane-2,2-diol |
|---|---|
| PubChem CID | 142318317 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 7-(3-but-3-enylcyclopentyl)pyrrolo[2,3-d]pyrimidin-4-amine;propane-2,2-diol |
| SMILES | C=CCCC1CCC(n2ccc3c(N)ncnc32)C1.CC(C)(O)O |
| InChI | InChI=1S/C15H20N4.C3H8O2/c1-2-3-4-11-5-6-12(9-11)19-8-7-13-14(16)17-10-18-15(13)19;1-3(2,4)5/h2,7-8,10-12H,1,3-6,9H2,(H2,16,17,18);4-5H,1-2H3 |
| InChIKey | BUVWMSQJSMBLSY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|