C27H35N5O2 — CID 145263698
ethane;propane-2,2-diol;7-[3-[(E)-2-quinolin-7-ylethenyl]cyclopentyl]pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 145263698) has the molecular formula C27H35N5O2 and a molecular weight of 461.61 g/mol. Its IUPAC name is ethane;propane-2,2-diol;7-[3-[(E)-2-quinolin-7-ylethenyl]cyclopentyl]pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | ethane;propane-2,2-diol;7-[3-[(E)-2-quinolin-7-ylethenyl]cyclopentyl]pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 145263698 |
| Molecular Formula | C27H35N5O2 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.28 |
| IUPAC Name | ethane;propane-2,2-diol;7-[3-[(E)-2-quinolin-7-ylethenyl]cyclopentyl]pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CC.CC(C)(O)O.Nc1ncnc2c1ccn2C1CCC(/C=C/c2ccc3cccnc3c2)C1 |
| InChI | InChI=1S/C22H21N5.C3H8O2.C2H6/c23-21-19-9-11-27(22(19)26-14-25-21)18-8-6-15(12-18)3-4-16-5-7-17-2-1-10-24-20(17)13-16;1-3(2,4)5;1-2/h1-5,7,9-11,13-15,18H,6,8,12H2,(H2,23,25,26);4-5H,1-2H3;1-2H3/b4-3+;; |
| InChIKey | OZRPGJZIJDZDII-CZEFNJPISA-N |
| XLogP | 5.35 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|