C25H24ClN5O2 — CID 126637654
7-[(3aS,4R,6R,6aR)-6-[(E)-2-(3-chloroquinolin-7-yl)ethenyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 126637654) has the molecular formula C25H24ClN5O2 and a molecular weight of 461.95 g/mol. Its IUPAC name is 7-[(3aS,4R,6R,6aR)-6-[(E)-2-(3-chloroquinolin-7-yl)ethenyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-[(3aS,4R,6R,6aR)-6-[(E)-2-(3-chloroquinolin-7-yl)ethenyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 126637654 |
| Molecular Formula | C25H24ClN5O2 |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 7-[(3aS,4R,6R,6aR)-6-[(E)-2-(3-chloroquinolin-7-yl)ethenyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](/C=C/c1ccc3cc(Cl)cnc3c1)C[C@H]2n1ccc2c(N)ncnc21 |
| InChI | InChI=1S/C25H24ClN5O2/c1-25(2)32-21-16(6-4-14-3-5-15-10-17(26)12-28-19(15)9-14)11-20(22(21)33-25)31-8-7-18-23(27)29-13-30-24(18)31/h3-10,12-13,16,20-22H,11H2,1-2H3,(H2,27,29,30)/b6-4+/t16-,20+,21+,22-/m0/s1 |
| InChIKey | ISQOZYRLAZAMPQ-NAYUQLQZSA-N |
| XLogP | 5.01 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |