C21H23ClN4O3 — CID 135318307
[(3aS,4R,6R,6aR)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-(4-chlorophenyl)methanol (PubChem CID 135318307) has the molecular formula C21H23ClN4O3 and a molecular weight of 414.89 g/mol. Its IUPAC name is [(3aS,4R,6R,6aR)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-(4-chlorophenyl)methanol.
| Compound Name | [(3aS,4R,6R,6aR)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-(4-chlorophenyl)methanol |
|---|---|
| PubChem CID | 135318307 |
| Molecular Formula | C21H23ClN4O3 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | [(3aS,4R,6R,6aR)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-(4-chlorophenyl)methanol |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](C(O)c1ccc(Cl)cc1)C[C@H]2n1ccc2c(N)ncnc21 |
| InChI | InChI=1S/C21H23ClN4O3/c1-21(2)28-17-14(16(27)11-3-5-12(22)6-4-11)9-15(18(17)29-21)26-8-7-13-19(23)24-10-25-20(13)26/h3-8,10,14-18,27H,9H2,1-2H3,(H2,23,24,25)/t14-,15-,16?,17-,18+/m1/s1 |
| InChIKey | LEFVPKLWDHQFOX-VUCRHFMTSA-N |
| XLogP | 3.48 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |