C21H21F3N4O4 — CID 122669390
[(3aR,4R,6R,6aR)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-[4-(trifluoromethyl)phenyl]methanol (PubChem CID 122669390) has the molecular formula C21H21F3N4O4 and a molecular weight of 450.42 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-[4-(trifluoromethyl)phenyl]methanol.
| Compound Name | [(3aR,4R,6R,6aR)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-[4-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 122669390 |
| Molecular Formula | C21H21F3N4O4 |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | [(3aR,4R,6R,6aR)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-[4-(trifluoromethyl)phenyl]methanol |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](C(O)c1ccc(C(F)(F)F)cc1)O[C@H]2n1ccc2c(N)ncnc21 |
| InChI | InChI=1S/C21H21F3N4O4/c1-20(2)31-15-14(13(29)10-3-5-11(6-4-10)21(22,23)24)30-19(16(15)32-20)28-8-7-12-17(25)26-9-27-18(12)28/h3-9,13-16,19,29H,1-2H3,(H2,25,26,27)/t13?,14-,15-,16-,19-/m1/s1 |
| InChIKey | SMBCOEIUGLIWKA-TVKLTONJSA-N |
| XLogP | 3.18 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |