C21H24N6O2 — CID 134417084
7-[(3aS,4R,6R,6aR)-6-[(E)-2-(2-amino-4-pyridinyl)ethenyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 134417084) has the molecular formula C21H24N6O2 and a molecular weight of 392.46 g/mol. Its IUPAC name is 7-[(3aS,4R,6R,6aR)-6-[(E)-2-(2-amino-4-pyridinyl)ethenyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-[(3aS,4R,6R,6aR)-6-[(E)-2-(2-amino-4-pyridinyl)ethenyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 134417084 |
| Molecular Formula | C21H24N6O2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 7-[(3aS,4R,6R,6aR)-6-[(E)-2-(2-amino-4-pyridinyl)ethenyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](/C=C/c1ccnc(N)c1)C[C@H]2n1ccc2c(N)ncnc21 |
| InChI | InChI=1S/C21H24N6O2/c1-21(2)28-17-13(4-3-12-5-7-24-16(22)9-12)10-15(18(17)29-21)27-8-6-14-19(23)25-11-26-20(14)27/h3-9,11,13,15,17-18H,10H2,1-2H3,(H2,22,24)(H2,23,25,26)/b4-3+/t13-,15+,17+,18-/m0/s1 |
| InChIKey | LWJCGVRAIKJPEW-WALIUZDESA-N |
| XLogP | 2.79 |
| TPSA | 114.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |