C21H22BrClN4O3 — CID 135318671
[(3aS,4R,6R,6aR)-4-(4-amino-5-bromopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-(4-chlorophenyl)methanol (PubChem CID 135318671) has the molecular formula C21H22BrClN4O3 and a molecular weight of 493.79 g/mol. Its IUPAC name is [(3aS,4R,6R,6aR)-4-(4-amino-5-bromopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-(4-chlorophenyl)methanol.
| Compound Name | [(3aS,4R,6R,6aR)-4-(4-amino-5-bromopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-(4-chlorophenyl)methanol |
|---|---|
| PubChem CID | 135318671 |
| Molecular Formula | C21H22BrClN4O3 |
| Molecular Weight | 493.79 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | [(3aS,4R,6R,6aR)-4-(4-amino-5-bromopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-(4-chlorophenyl)methanol |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](C(O)c1ccc(Cl)cc1)C[C@H]2n1cc(Br)c2c(N)ncnc21 |
| InChI | InChI=1S/C21H22BrClN4O3/c1-21(2)29-17-12(16(28)10-3-5-11(23)6-4-10)7-14(18(17)30-21)27-8-13(22)15-19(24)25-9-26-20(15)27/h3-6,8-9,12,14,16-18,28H,7H2,1-2H3,(H2,24,25,26)/t12-,14-,16?,17-,18+/m1/s1 |
| InChIKey | LBSQRMWYHOVQBM-VMHCXLKLSA-N |
| XLogP | 4.24 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.79 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |