C24H26ClN5O3 — CID 145263672
7-[(2R,5S)-5-[(E)-2-(3-chloroquinolin-7-yl)ethenyl]oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-amine;propane-2,2-diol (PubChem CID 145263672) has the molecular formula C24H26ClN5O3 and a molecular weight of 467.96 g/mol. Its IUPAC name is 7-[(2R,5S)-5-[(E)-2-(3-chloroquinolin-7-yl)ethenyl]oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-amine;propane-2,2-diol.
| Compound Name | 7-[(2R,5S)-5-[(E)-2-(3-chloroquinolin-7-yl)ethenyl]oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-amine;propane-2,2-diol |
|---|---|
| PubChem CID | 145263672 |
| Molecular Formula | C24H26ClN5O3 |
| Molecular Weight | 467.96 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 7-[(2R,5S)-5-[(E)-2-(3-chloroquinolin-7-yl)ethenyl]oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-amine;propane-2,2-diol |
| SMILES | CC(C)(O)O.Nc1ncnc2c1ccn2[C@H]1CC[C@@H](/C=C/c2ccc3cc(Cl)cnc3c2)O1 |
| InChI | InChI=1S/C21H18ClN5O.C3H8O2/c22-15-10-14-3-1-13(9-18(14)24-11-15)2-4-16-5-6-19(28-16)27-8-7-17-20(23)25-12-26-21(17)27;1-3(2,4)5/h1-4,7-12,16,19H,5-6H2,(H2,23,25,26);4-5H,1-2H3/b4-2+;/t16-,19-;/m1./s1 |
| InChIKey | ZQKBQUJZEWCAEN-LMFVQWKPSA-N |
| XLogP | 4.31 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.96 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|