C16H23ClN4O5 — CID 145183395
5-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-N-methoxy-N-methyloxolane-2-carboxamide;propane-2,2-diol (PubChem CID 145183395) has the molecular formula C16H23ClN4O5 and a molecular weight of 386.84 g/mol. Its IUPAC name is 5-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-N-methoxy-N-methyloxolane-2-carboxamide;propane-2,2-diol.
| Compound Name | 5-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-N-methoxy-N-methyloxolane-2-carboxamide;propane-2,2-diol |
|---|---|
| PubChem CID | 145183395 |
| Molecular Formula | C16H23ClN4O5 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 5-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-N-methoxy-N-methyloxolane-2-carboxamide;propane-2,2-diol |
| SMILES | CC(C)(O)O.CON(C)C(=O)C1CCC(n2ccc3c(Cl)ncnc32)O1 |
| InChI | InChI=1S/C13H15ClN4O3.C3H8O2/c1-17(20-2)13(19)9-3-4-10(21-9)18-6-5-8-11(14)15-7-16-12(8)18;1-3(2,4)5/h5-7,9-10H,3-4H2,1-2H3;4-5H,1-2H3 |
| InChIKey | SJBGXJDPTVDGKR-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 109.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|