C17H22ClN3O3 — CID 155185192
2-[[(1S,2R,3R,4R,5S)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-1-(hydroxymethyl)-2-methyl-3-bicyclo[3.1.0]hexanyl]oxy]propan-2-ol (PubChem CID 155185192) has the molecular formula C17H22ClN3O3 and a molecular weight of 351.83 g/mol. Its IUPAC name is 2-[[(1S,2R,3R,4R,5S)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-1-(hydroxymethyl)-2-methyl-3-bicyclo[3.1.0]hexanyl]oxy]propan-2-ol.
| Compound Name | 2-[[(1S,2R,3R,4R,5S)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-1-(hydroxymethyl)-2-methyl-3-bicyclo[3.1.0]hexanyl]oxy]propan-2-ol |
|---|---|
| PubChem CID | 155185192 |
| Molecular Formula | C17H22ClN3O3 |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 2-[[(1S,2R,3R,4R,5S)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-1-(hydroxymethyl)-2-methyl-3-bicyclo[3.1.0]hexanyl]oxy]propan-2-ol |
| SMILES | C[C@H]1[C@@H](OC(C)(C)O)[C@H](n2ccc3c(Cl)ncnc32)[C@H]2C[C@]21CO |
| InChI | InChI=1S/C17H22ClN3O3/c1-9-13(24-16(2,3)23)12(11-6-17(9,11)7-22)21-5-4-10-14(18)19-8-20-15(10)21/h4-5,8-9,11-13,22-23H,6-7H2,1-3H3/t9-,11+,12+,13+,17+/m0/s1 |
| InChIKey | VSBCLDCAVURKDX-UWBCHEKGSA-N |
| XLogP | 2.39 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|