C15H22ClN3O4 — CID 142528248
[5-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-3-methyloxolan-2-yl]methanol;propane-2,2-diol (PubChem CID 142528248) has the molecular formula C15H22ClN3O4 and a molecular weight of 343.81 g/mol. Its IUPAC name is [5-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-3-methyloxolan-2-yl]methanol;propane-2,2-diol.
| Compound Name | [5-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-3-methyloxolan-2-yl]methanol;propane-2,2-diol |
|---|---|
| PubChem CID | 142528248 |
| Molecular Formula | C15H22ClN3O4 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | [5-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-3-methyloxolan-2-yl]methanol;propane-2,2-diol |
| SMILES | CC(C)(O)O.CC1CC(n2ccc3c(Cl)ncnc32)OC1CO |
| InChI | InChI=1S/C12H14ClN3O2.C3H8O2/c1-7-4-10(18-9(7)5-17)16-3-2-8-11(13)14-6-15-12(8)16;1-3(2,4)5/h2-3,6-7,9-10,17H,4-5H2,1H3;4-5H,1-2H3 |
| InChIKey | YUJKLFHONIPPQZ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|