C13H15ClFN3O4 — CID 89372077
(2R,3S,4R,6S,7R)-7-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-6-fluoro-2-(hydroxymethyl)oxepane-3,4-diol (PubChem CID 89372077) has the molecular formula C13H15ClFN3O4 and a molecular weight of 331.73 g/mol. Its IUPAC name is (2R,3S,4R,6S,7R)-7-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-6-fluoro-2-(hydroxymethyl)oxepane-3,4-diol.
| Compound Name | (2R,3S,4R,6S,7R)-7-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-6-fluoro-2-(hydroxymethyl)oxepane-3,4-diol |
|---|---|
| PubChem CID | 89372077 |
| Molecular Formula | C13H15ClFN3O4 |
| Molecular Weight | 331.73 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | (2R,3S,4R,6S,7R)-7-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-6-fluoro-2-(hydroxymethyl)oxepane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2ccc3c(Cl)ncnc32)[C@@H](F)C[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H15ClFN3O4/c14-11-6-1-2-18(12(6)17-5-16-11)13-7(15)3-8(20)10(21)9(4-19)22-13/h1-2,5,7-10,13,19-21H,3-4H2/t7-,8+,9+,10-,13+/m0/s1 |
| InChIKey | SLWUTAAXJCVFGM-XGJGVMOOSA-N |
| XLogP | 0.42 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.73 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |