C20H20Cl3N3O4 — CID 155175387
2-[(2R,3S)-5-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2-[(3,4-dichlorophenyl)-hydroxymethyl]oxolan-3-yl]oxypropan-2-ol (PubChem CID 155175387) has the molecular formula C20H20Cl3N3O4 and a molecular weight of 472.76 g/mol. Its IUPAC name is 2-[(2R,3S)-5-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2-[(3,4-dichlorophenyl)-hydroxymethyl]oxolan-3-yl]oxypropan-2-ol.
| Compound Name | 2-[(2R,3S)-5-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2-[(3,4-dichlorophenyl)-hydroxymethyl]oxolan-3-yl]oxypropan-2-ol |
|---|---|
| PubChem CID | 155175387 |
| Molecular Formula | C20H20Cl3N3O4 |
| Molecular Weight | 472.76 g/mol |
| Exact Mass | 471.05 |
| IUPAC Name | 2-[(2R,3S)-5-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2-[(3,4-dichlorophenyl)-hydroxymethyl]oxolan-3-yl]oxypropan-2-ol |
| SMILES | CC(C)(O)O[C@H]1CC(n2ccc3c(Cl)ncnc32)O[C@@H]1C(O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H20Cl3N3O4/c1-20(2,28)30-14-8-15(26-6-5-11-18(23)24-9-25-19(11)26)29-17(14)16(27)10-3-4-12(21)13(22)7-10/h3-7,9,14-17,27-28H,8H2,1-2H3/t14-,15?,16?,17-/m0/s1 |
| InChIKey | KVSQODVUKINABJ-OTBWCIGPSA-N |
| XLogP | 4.53 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.76 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|