C18H26N4O5 — CID 142528205
3-(2-hydroxypropan-2-yloxy)-N-methoxy-N,3-dimethyl-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-2-carboxamide (PubChem CID 142528205) has the molecular formula C18H26N4O5 and a molecular weight of 378.43 g/mol. Its IUPAC name is 3-(2-hydroxypropan-2-yloxy)-N-methoxy-N,3-dimethyl-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-2-carboxamide.
| Compound Name | 3-(2-hydroxypropan-2-yloxy)-N-methoxy-N,3-dimethyl-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 142528205 |
| Molecular Formula | C18H26N4O5 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 3-(2-hydroxypropan-2-yloxy)-N-methoxy-N,3-dimethyl-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-2-carboxamide |
| SMILES | CON(C)C(=O)C1OC(n2ccc3c(C)ncnc32)CC1(C)OC(C)(C)O |
| InChI | InChI=1S/C18H26N4O5/c1-11-12-7-8-22(15(12)20-10-19-11)13-9-18(4,27-17(2,3)24)14(26-13)16(23)21(5)25-6/h7-8,10,13-14,24H,9H2,1-6H3 |
| InChIKey | MBYZKASYJSAZCB-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 98.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|