C18H20F3N3O6S — CID 156756370
[(1R,5R,6R,8R,9R)-3,3-dimethyl-6-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2,4,7-trioxatricyclo[6.3.0.01,5]undecan-9-yl] trifluoromethanesulfonate (PubChem CID 156756370) has the molecular formula C18H20F3N3O6S and a molecular weight of 463.43 g/mol. Its IUPAC name is [(1R,5R,6R,8R,9R)-3,3-dimethyl-6-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2,4,7-trioxatricyclo[6.3.0.01,5]undecan-9-yl] trifluoromethanesulfonate.
| Compound Name | [(1R,5R,6R,8R,9R)-3,3-dimethyl-6-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2,4,7-trioxatricyclo[6.3.0.01,5]undecan-9-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 156756370 |
| Molecular Formula | C18H20F3N3O6S |
| Molecular Weight | 463.43 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | [(1R,5R,6R,8R,9R)-3,3-dimethyl-6-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2,4,7-trioxatricyclo[6.3.0.01,5]undecan-9-yl] trifluoromethanesulfonate |
| SMILES | Cc1ncnc2c1ccn2[C@@H]1O[C@@H]2[C@H](OS(=O)(=O)C(F)(F)F)CC[C@@]23OC(C)(C)O[C@@H]13 |
| InChI | InChI=1S/C18H20F3N3O6S/c1-9-10-5-7-24(14(10)23-8-22-9)15-13-17(30-16(2,3)28-13)6-4-11(12(17)27-15)29-31(25,26)18(19,20)21/h5,7-8,11-13,15H,4,6H2,1-3H3/t11-,12-,13+,15-,17-/m1/s1 |
| InChIKey | LUDARCXYYHFGJX-HGKPHOSTSA-N |
| XLogP | 2.56 |
| TPSA | 101.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|