C25H28N6O7 — CID 138521086
bis[(1S,2S,3S,4R)-2,3-dihydroxy-4-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl] carbonate (PubChem CID 138521086) has the molecular formula C25H28N6O7 and a molecular weight of 524.53 g/mol. Its IUPAC name is bis[(1S,2S,3S,4R)-2,3-dihydroxy-4-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl] carbonate.
| Compound Name | bis[(1S,2S,3S,4R)-2,3-dihydroxy-4-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl] carbonate |
|---|---|
| PubChem CID | 138521086 |
| Molecular Formula | C25H28N6O7 |
| Molecular Weight | 524.53 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | bis[(1S,2S,3S,4R)-2,3-dihydroxy-4-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl] carbonate |
| SMILES | Cc1ncnc2c1ccn2[C@@H]1C[C@H](OC(=O)O[C@H]2C[C@@H](n3ccc4c(C)ncnc43)[C@H](O)[C@@H]2O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C25H28N6O7/c1-11-13-3-5-30(23(13)28-9-26-11)15-7-17(21(34)19(15)32)37-25(36)38-18-8-16(20(33)22(18)35)31-6-4-14-12(2)27-10-29-24(14)31/h3-6,9-10,15-22,32-35H,7-8H2,1-2H3/t15-,16-,17+,18+,19+,20+,21-,22-/m1/s1 |
| InChIKey | RTMKAMBKGIHDOB-PSGZAVAVSA-N |
| XLogP | 0.72 |
| TPSA | 177.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.53 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |