C13H18N4O5S — CID 58944623
[(1S,2R,3S,4R)-2,3-dihydroxy-4-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]methyl sulfamate (PubChem CID 58944623) has the molecular formula C13H18N4O5S and a molecular weight of 342.38 g/mol. Its IUPAC name is [(1S,2R,3S,4R)-2,3-dihydroxy-4-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]methyl sulfamate.
| Compound Name | [(1S,2R,3S,4R)-2,3-dihydroxy-4-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 58944623 |
| Molecular Formula | C13H18N4O5S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | [(1S,2R,3S,4R)-2,3-dihydroxy-4-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]methyl sulfamate |
| SMILES | Cc1ncnc2c1ccn2[C@@H]1C[C@@H](COS(N)(=O)=O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H18N4O5S/c1-7-9-2-3-17(13(9)16-6-15-7)10-4-8(11(18)12(10)19)5-22-23(14,20)21/h2-3,6,8,10-12,18-19H,4-5H2,1H3,(H2,14,20,21)/t8-,10+,11+,12-/m0/s1 |
| InChIKey | RAZIJUXMFWFWKG-GMNPVEAJSA-N |
| XLogP | -0.76 |
| TPSA | 140.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |