C13H16N4O3S — CID 58944575
[(1R,4R)-4-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)cyclopent-2-en-1-yl]methyl sulfamate (PubChem CID 58944575) has the molecular formula C13H16N4O3S and a molecular weight of 308.36 g/mol. Its IUPAC name is [(1R,4R)-4-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)cyclopent-2-en-1-yl]methyl sulfamate.
| Compound Name | [(1R,4R)-4-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)cyclopent-2-en-1-yl]methyl sulfamate |
|---|---|
| PubChem CID | 58944575 |
| Molecular Formula | C13H16N4O3S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | [(1R,4R)-4-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)cyclopent-2-en-1-yl]methyl sulfamate |
| SMILES | Cc1ncnc2c1ccn2[C@H]1C=C[C@H](COS(N)(=O)=O)C1 |
| InChI | InChI=1S/C13H16N4O3S/c1-9-12-4-5-17(13(12)16-8-15-9)11-3-2-10(6-11)7-20-21(14,18)19/h2-5,8,10-11H,6-7H2,1H3,(H2,14,18,19)/t10-,11-/m0/s1 |
| InChIKey | BCAZEQOBCLTRMZ-QWRGUYRKSA-N |
| XLogP | 1.08 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|