C22H27N5O4S — CID 87839586
[(1R,2R,4S)-2-hydroxy-4-[4-[[(1R,2R)-2-methyl-2,3-dihydro-1H-inden-1-yl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentyl]methyl sulfamate (PubChem CID 87839586) has the molecular formula C22H27N5O4S and a molecular weight of 457.56 g/mol. Its IUPAC name is [(1R,2R,4S)-2-hydroxy-4-[4-[[(1R,2R)-2-methyl-2,3-dihydro-1H-inden-1-yl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentyl]methyl sulfamate.
| Compound Name | [(1R,2R,4S)-2-hydroxy-4-[4-[[(1R,2R)-2-methyl-2,3-dihydro-1H-inden-1-yl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 87839586 |
| Molecular Formula | C22H27N5O4S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | [(1R,2R,4S)-2-hydroxy-4-[4-[[(1R,2R)-2-methyl-2,3-dihydro-1H-inden-1-yl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentyl]methyl sulfamate |
| SMILES | C[C@@H]1Cc2ccccc2[C@@H]1Nc1ncnc2c1ccn2[C@H]1C[C@H](COS(N)(=O)=O)[C@H](O)C1 |
| InChI | InChI=1S/C22H27N5O4S/c1-13-8-14-4-2-3-5-17(14)20(13)26-21-18-6-7-27(22(18)25-12-24-21)16-9-15(19(28)10-16)11-31-32(23,29)30/h2-7,12-13,15-16,19-20,28H,8-11H2,1H3,(H2,23,29,30)(H,24,25,26)/t13-,15-,16+,19-,20-/m1/s1 |
| InChIKey | IVHHBJVUCGEDGI-PALCPLIKSA-N |
| XLogP | 2.31 |
| TPSA | 132.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |