C22H28N6O4S — CID 58944700
7-[(1R,3S,4S)-3-hydroxy-4-[(sulfamoylamino)methyl]cyclopentyl]-4-[[(1R,2S)-2-methoxy-2,3-dihydro-1H-inden-1-yl]amino]pyrrolo[2,3-d]pyrimidine (PubChem CID 58944700) has the molecular formula C22H28N6O4S and a molecular weight of 472.57 g/mol. Its IUPAC name is 7-[(1R,3S,4S)-3-hydroxy-4-[(sulfamoylamino)methyl]cyclopentyl]-4-[[(1R,2S)-2-methoxy-2,3-dihydro-1H-inden-1-yl]amino]pyrrolo[2,3-d]pyrimidine.
| Compound Name | 7-[(1R,3S,4S)-3-hydroxy-4-[(sulfamoylamino)methyl]cyclopentyl]-4-[[(1R,2S)-2-methoxy-2,3-dihydro-1H-inden-1-yl]amino]pyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 58944700 |
| Molecular Formula | C22H28N6O4S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 7-[(1R,3S,4S)-3-hydroxy-4-[(sulfamoylamino)methyl]cyclopentyl]-4-[[(1R,2S)-2-methoxy-2,3-dihydro-1H-inden-1-yl]amino]pyrrolo[2,3-d]pyrimidine |
| SMILES | CO[C@H]1Cc2ccccc2[C@H]1Nc1ncnc2c1ccn2[C@@H]1C[C@@H](CNS(N)(=O)=O)[C@@H](O)C1 |
| InChI | InChI=1S/C22H28N6O4S/c1-32-19-9-13-4-2-3-5-16(13)20(19)27-21-17-6-7-28(22(17)25-12-24-21)15-8-14(18(29)10-15)11-26-33(23,30)31/h2-7,12,14-15,18-20,26,29H,8-11H2,1H3,(H2,23,30,31)(H,24,25,27)/t14-,15+,18-,19-,20+/m0/s1 |
| InChIKey | AQOKKJFGZVTMSU-SBCNTATESA-N |
| XLogP | 1.26 |
| TPSA | 144.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |