C20H27N5O5S — CID 71272473
[(1S,2S,4R)-2-hydroxy-4-[[6-[[(1R,2S)-2-methoxy-2,3-dihydro-1H-inden-1-yl]amino]pyrimidin-4-yl]amino]cyclopentyl]methylsulfamic acid (PubChem CID 71272473) has the molecular formula C20H27N5O5S and a molecular weight of 449.53 g/mol. Its IUPAC name is [(1S,2S,4R)-2-hydroxy-4-[[6-[[(1R,2S)-2-methoxy-2,3-dihydro-1H-inden-1-yl]amino]pyrimidin-4-yl]amino]cyclopentyl]methylsulfamic acid.
| Compound Name | [(1S,2S,4R)-2-hydroxy-4-[[6-[[(1R,2S)-2-methoxy-2,3-dihydro-1H-inden-1-yl]amino]pyrimidin-4-yl]amino]cyclopentyl]methylsulfamic acid |
|---|---|
| PubChem CID | 71272473 |
| Molecular Formula | C20H27N5O5S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | [(1S,2S,4R)-2-hydroxy-4-[[6-[[(1R,2S)-2-methoxy-2,3-dihydro-1H-inden-1-yl]amino]pyrimidin-4-yl]amino]cyclopentyl]methylsulfamic acid |
| SMILES | CO[C@H]1Cc2ccccc2[C@H]1Nc1cc(N[C@@H]2C[C@@H](CNS(=O)(=O)O)[C@@H](O)C2)ncn1 |
| InChI | InChI=1S/C20H27N5O5S/c1-30-17-7-12-4-2-3-5-15(12)20(17)25-19-9-18(21-11-22-19)24-14-6-13(16(26)8-14)10-23-31(27,28)29/h2-5,9,11,13-14,16-17,20,23,26H,6-8,10H2,1H3,(H,27,28,29)(H2,21,22,24,25)/t13-,14+,16-,17-,20+/m0/s1 |
| InChIKey | UKRWHDZGXSITNT-BXNDMCELSA-N |
| XLogP | 1.14 |
| TPSA | 145.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|