C20H25N3O7S — CID 59671203
[(1S,2S,4R)-2-hydroxy-4-[6-[[(1R,2S)-2-methoxy-2,3-dihydro-1H-inden-1-yl]oxy]pyrimidin-4-yl]oxycyclopentyl]methyl sulfamate (PubChem CID 59671203) has the molecular formula C20H25N3O7S and a molecular weight of 451.50 g/mol. Its IUPAC name is [(1S,2S,4R)-2-hydroxy-4-[6-[[(1R,2S)-2-methoxy-2,3-dihydro-1H-inden-1-yl]oxy]pyrimidin-4-yl]oxycyclopentyl]methyl sulfamate.
| Compound Name | [(1S,2S,4R)-2-hydroxy-4-[6-[[(1R,2S)-2-methoxy-2,3-dihydro-1H-inden-1-yl]oxy]pyrimidin-4-yl]oxycyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 59671203 |
| Molecular Formula | C20H25N3O7S |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | [(1S,2S,4R)-2-hydroxy-4-[6-[[(1R,2S)-2-methoxy-2,3-dihydro-1H-inden-1-yl]oxy]pyrimidin-4-yl]oxycyclopentyl]methyl sulfamate |
| SMILES | CO[C@H]1Cc2ccccc2[C@H]1Oc1cc(O[C@@H]2C[C@@H](COS(N)(=O)=O)[C@@H](O)C2)ncn1 |
| InChI | InChI=1S/C20H25N3O7S/c1-27-17-7-12-4-2-3-5-15(12)20(17)30-19-9-18(22-11-23-19)29-14-6-13(16(24)8-14)10-28-31(21,25)26/h2-5,9,11,13-14,16-17,20,24H,6-8,10H2,1H3,(H2,21,25,26)/t13-,14+,16-,17-,20+/m0/s1 |
| InChIKey | KXEDUHGELOKWOR-BXNDMCELSA-N |
| XLogP | 0.91 |
| TPSA | 143.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |