C22H31N5O5S — CID 59671400
[(1S,2S,4R)-4-[6-[[(1S,2R)-2-[(dimethylamino)methyl]-2,3-dihydro-1H-inden-1-yl]amino]pyrimidin-4-yl]oxy-2-hydroxycyclopentyl]methyl sulfamate (PubChem CID 59671400) has the molecular formula C22H31N5O5S and a molecular weight of 477.59 g/mol. Its IUPAC name is [(1S,2S,4R)-4-[6-[[(1S,2R)-2-[(dimethylamino)methyl]-2,3-dihydro-1H-inden-1-yl]amino]pyrimidin-4-yl]oxy-2-hydroxycyclopentyl]methyl sulfamate.
| Compound Name | [(1S,2S,4R)-4-[6-[[(1S,2R)-2-[(dimethylamino)methyl]-2,3-dihydro-1H-inden-1-yl]amino]pyrimidin-4-yl]oxy-2-hydroxycyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 59671400 |
| Molecular Formula | C22H31N5O5S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | [(1S,2S,4R)-4-[6-[[(1S,2R)-2-[(dimethylamino)methyl]-2,3-dihydro-1H-inden-1-yl]amino]pyrimidin-4-yl]oxy-2-hydroxycyclopentyl]methyl sulfamate |
| SMILES | CN(C)C[C@H]1Cc2ccccc2[C@H]1Nc1cc(O[C@@H]2C[C@@H](COS(N)(=O)=O)[C@@H](O)C2)ncn1 |
| InChI | InChI=1S/C22H31N5O5S/c1-27(2)11-15-7-14-5-3-4-6-18(14)22(15)26-20-10-21(25-13-24-20)32-17-8-16(19(28)9-17)12-31-33(23,29)30/h3-6,10,13,15-17,19,22,28H,7-9,11-12H2,1-2H3,(H2,23,29,30)(H,24,25,26)/t15-,16+,17-,19+,22+/m1/s1 |
| InChIKey | NDZNDPNVCPKYMJ-LCIUTUHKSA-N |
| XLogP | 1.10 |
| TPSA | 139.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |