C22H30N4O7S — CID 59671252
[(1S,2S,4R)-4-[6-[[(1S,2R)-2,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]amino]pyrimidin-4-yl]oxy-2-hydroxycyclopentyl]methyl sulfamate (PubChem CID 59671252) has the molecular formula C22H30N4O7S and a molecular weight of 494.57 g/mol. Its IUPAC name is [(1S,2S,4R)-4-[6-[[(1S,2R)-2,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]amino]pyrimidin-4-yl]oxy-2-hydroxycyclopentyl]methyl sulfamate.
| Compound Name | [(1S,2S,4R)-4-[6-[[(1S,2R)-2,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]amino]pyrimidin-4-yl]oxy-2-hydroxycyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 59671252 |
| Molecular Formula | C22H30N4O7S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | [(1S,2S,4R)-4-[6-[[(1S,2R)-2,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]amino]pyrimidin-4-yl]oxy-2-hydroxycyclopentyl]methyl sulfamate |
| SMILES | COc1ccc2c(c1)[C@H](Nc1cc(O[C@@H]3C[C@@H](COS(N)(=O)=O)[C@@H](O)C3)ncn1)[C@H](OC)CC2 |
| InChI | InChI=1S/C22H30N4O7S/c1-30-15-5-3-13-4-6-19(31-2)22(17(13)8-15)26-20-10-21(25-12-24-20)33-16-7-14(18(27)9-16)11-32-34(23,28)29/h3,5,8,10,12,14,16,18-19,22,27H,4,6-7,9,11H2,1-2H3,(H2,23,28,29)(H,24,25,26)/t14-,16+,18-,19+,22-/m0/s1 |
| InChIKey | MCALKOUCNUORLI-WBJUIPRCSA-N |
| XLogP | 1.34 |
| TPSA | 155.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |