C19H24ClN5O5S — CID 59671199
[(1R,2R,3S,4R)-4-[[6-[[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]amino]pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate (PubChem CID 59671199) has the molecular formula C19H24ClN5O5S and a molecular weight of 469.95 g/mol. Its IUPAC name is [(1R,2R,3S,4R)-4-[[6-[[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]amino]pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate.
| Compound Name | [(1R,2R,3S,4R)-4-[[6-[[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]amino]pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 59671199 |
| Molecular Formula | C19H24ClN5O5S |
| Molecular Weight | 469.95 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | [(1R,2R,3S,4R)-4-[[6-[[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]amino]pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate |
| SMILES | NS(=O)(=O)OC[C@H]1C[C@@H](Nc2cc(N[C@H]3CCc4cc(Cl)ccc43)ncn2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H24ClN5O5S/c20-12-2-3-13-10(5-12)1-4-14(13)24-16-7-17(23-9-22-16)25-15-6-11(18(26)19(15)27)8-30-31(21,28)29/h2-3,5,7,9,11,14-15,18-19,26-27H,1,4,6,8H2,(H2,21,28,29)(H2,22,23,24,25)/t11-,14+,15-,18-,19+/m1/s1 |
| InChIKey | GKZNYYOAUDYHPO-OVBCXQRJSA-N |
| XLogP | 0.97 |
| TPSA | 159.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.95 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |