C9H16N6O5S — CID 87160194
[(1R,2R,3S,4R)-4-[(4-amino-1,3,5-triazin-2-yl)amino]-2,3-dihydroxycyclopentyl]methyl sulfamate (PubChem CID 87160194) has the molecular formula C9H16N6O5S and a molecular weight of 320.33 g/mol. Its IUPAC name is [(1R,2R,3S,4R)-4-[(4-amino-1,3,5-triazin-2-yl)amino]-2,3-dihydroxycyclopentyl]methyl sulfamate.
| Compound Name | [(1R,2R,3S,4R)-4-[(4-amino-1,3,5-triazin-2-yl)amino]-2,3-dihydroxycyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 87160194 |
| Molecular Formula | C9H16N6O5S |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | [(1R,2R,3S,4R)-4-[(4-amino-1,3,5-triazin-2-yl)amino]-2,3-dihydroxycyclopentyl]methyl sulfamate |
| SMILES | Nc1ncnc(N[C@@H]2C[C@H](COS(N)(=O)=O)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C9H16N6O5S/c10-8-12-3-13-9(15-8)14-5-1-4(6(16)7(5)17)2-20-21(11,18)19/h3-7,16-17H,1-2H2,(H2,11,18,19)(H3,10,12,13,14,15)/t4-,5-,6-,7+/m1/s1 |
| InChIKey | QHZDDJBYFWZSQH-GBNDHIKLSA-N |
| XLogP | -2.80 |
| TPSA | 186.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |