C10H17N5O5S — CID 59671264
[(1R,2R,3S,4R)-2,3-dihydroxy-4-[(4-methyl-1,3,5-triazin-2-yl)amino]cyclopentyl]methyl sulfamate (PubChem CID 59671264) has the molecular formula C10H17N5O5S and a molecular weight of 319.34 g/mol. Its IUPAC name is [(1R,2R,3S,4R)-2,3-dihydroxy-4-[(4-methyl-1,3,5-triazin-2-yl)amino]cyclopentyl]methyl sulfamate.
| Compound Name | [(1R,2R,3S,4R)-2,3-dihydroxy-4-[(4-methyl-1,3,5-triazin-2-yl)amino]cyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 59671264 |
| Molecular Formula | C10H17N5O5S |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | [(1R,2R,3S,4R)-2,3-dihydroxy-4-[(4-methyl-1,3,5-triazin-2-yl)amino]cyclopentyl]methyl sulfamate |
| SMILES | Cc1ncnc(N[C@@H]2C[C@H](COS(N)(=O)=O)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C10H17N5O5S/c1-5-12-4-13-10(14-5)15-7-2-6(8(16)9(7)17)3-20-21(11,18)19/h4,6-9,16-17H,2-3H2,1H3,(H2,11,18,19)(H,12,13,14,15)/t6-,7-,8-,9+/m1/s1 |
| InChIKey | FPWZIWVVYHKHNV-BGZDPUMWSA-N |
| XLogP | -2.08 |
| TPSA | 160.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |