C9H16N6O3 — CID 156597623
(1R,2S,3R,5R)-3-[(4,6-diamino-1,3,5-triazin-2-yl)amino]-5-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 156597623) has the molecular formula C9H16N6O3 and a molecular weight of 256.27 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[(4,6-diamino-1,3,5-triazin-2-yl)amino]-5-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[(4,6-diamino-1,3,5-triazin-2-yl)amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 156597623 |
| Molecular Formula | C9H16N6O3 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | (1R,2S,3R,5R)-3-[(4,6-diamino-1,3,5-triazin-2-yl)amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | Nc1nc(N)nc(N[C@@H]2C[C@H](CO)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C9H16N6O3/c10-7-13-8(11)15-9(14-7)12-4-1-3(2-16)5(17)6(4)18/h3-6,16-18H,1-2H2,(H5,10,11,12,13,14,15)/t3-,4-,5-,6+/m1/s1 |
| InChIKey | XDLMEEFLNTUZGU-KAZBKCHUSA-N |
| XLogP | -2.45 |
| TPSA | 163.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |