C19H23ClN4O2 — CID 123388620
(1R,2S,3R,5R)-3-[[6-[[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]amino]pyrimidin-4-yl]amino]-5-methylcyclopentane-1,2-diol (PubChem CID 123388620) has the molecular formula C19H23ClN4O2 and a molecular weight of 374.87 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[[6-[[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]amino]pyrimidin-4-yl]amino]-5-methylcyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[[6-[[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]amino]pyrimidin-4-yl]amino]-5-methylcyclopentane-1,2-diol |
|---|---|
| PubChem CID | 123388620 |
| Molecular Formula | C19H23ClN4O2 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | (1R,2S,3R,5R)-3-[[6-[[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]amino]pyrimidin-4-yl]amino]-5-methylcyclopentane-1,2-diol |
| SMILES | C[C@@H]1C[C@@H](Nc2cc(N[C@H]3CCc4cc(Cl)ccc43)ncn2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H23ClN4O2/c1-10-6-15(19(26)18(10)25)24-17-8-16(21-9-22-17)23-14-5-2-11-7-12(20)3-4-13(11)14/h3-4,7-10,14-15,18-19,25-26H,2,5-6H2,1H3,(H2,21,22,23,24)/t10-,14+,15-,18-,19+/m1/s1 |
| InChIKey | JBWQNOSDSBBJPI-BLHUUYCUSA-N |
| XLogP | 2.77 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |