C14H9ClF4N2 — CID 133371686
N-(5-chloro-2,3-dihydro-1H-inden-1-yl)-2,3,5,6-tetrafluoropyridin-4-amine (PubChem CID 133371686) has the molecular formula C14H9ClF4N2 and a molecular weight of 316.69 g/mol. Its IUPAC name is N-(5-chloro-2,3-dihydro-1H-inden-1-yl)-2,3,5,6-tetrafluoropyridin-4-amine.
| Compound Name | N-(5-chloro-2,3-dihydro-1H-inden-1-yl)-2,3,5,6-tetrafluoropyridin-4-amine |
|---|---|
| PubChem CID | 133371686 |
| Molecular Formula | C14H9ClF4N2 |
| Molecular Weight | 316.69 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | N-(5-chloro-2,3-dihydro-1H-inden-1-yl)-2,3,5,6-tetrafluoropyridin-4-amine |
| SMILES | Fc1nc(F)c(F)c(NC2CCc3cc(Cl)ccc32)c1F |
| InChI | InChI=1S/C14H9ClF4N2/c15-7-2-3-8-6(5-7)1-4-9(8)20-12-10(16)13(18)21-14(19)11(12)17/h2-3,5,9H,1,4H2,(H,20,21) |
| InChIKey | HOOBZXAMWUCCSI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.69 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|