C15H12Cl2FN — CID 116531042
N-(2,6-dichlorophenyl)-5-fluoro-2,3-dihydro-1H-inden-1-amine (PubChem CID 116531042) has the molecular formula C15H12Cl2FN and a molecular weight of 296.17 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-5-fluoro-2,3-dihydro-1H-inden-1-amine.
| Compound Name | N-(2,6-dichlorophenyl)-5-fluoro-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 116531042 |
| Molecular Formula | C15H12Cl2FN |
| Molecular Weight | 296.17 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | N-(2,6-dichlorophenyl)-5-fluoro-2,3-dihydro-1H-inden-1-amine |
| SMILES | Fc1ccc2c(c1)CCC2Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H12Cl2FN/c16-12-2-1-3-13(17)15(12)19-14-7-4-9-8-10(18)5-6-11(9)14/h1-3,5-6,8,14,19H,4,7H2 |
| InChIKey | JDXDHJDAQOCDLX-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.17 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |