C15H12F3N — CID 116530973
N-(2,3-difluorophenyl)-5-fluoro-2,3-dihydro-1H-inden-1-amine (PubChem CID 116530973) has the molecular formula C15H12F3N and a molecular weight of 263.26 g/mol. Its IUPAC name is N-(2,3-difluorophenyl)-5-fluoro-2,3-dihydro-1H-inden-1-amine.
| Compound Name | N-(2,3-difluorophenyl)-5-fluoro-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 116530973 |
| Molecular Formula | C15H12F3N |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | N-(2,3-difluorophenyl)-5-fluoro-2,3-dihydro-1H-inden-1-amine |
| SMILES | Fc1ccc2c(c1)CCC2Nc1cccc(F)c1F |
| InChI | InChI=1S/C15H12F3N/c16-10-5-6-11-9(8-10)4-7-13(11)19-14-3-1-2-12(17)15(14)18/h1-3,5-6,8,13,19H,4,7H2 |
| InChIKey | GHOYJOLKOAMPEY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |