C16H14F2N2O — CID 116530881
4-fluoro-3-[(5-fluoro-2,3-dihydro-1H-inden-1-yl)amino]benzamide (PubChem CID 116530881) has the molecular formula C16H14F2N2O and a molecular weight of 288.30 g/mol. Its IUPAC name is 4-fluoro-3-[(5-fluoro-2,3-dihydro-1H-inden-1-yl)amino]benzamide.
| Compound Name | 4-fluoro-3-[(5-fluoro-2,3-dihydro-1H-inden-1-yl)amino]benzamide |
|---|---|
| PubChem CID | 116530881 |
| Molecular Formula | C16H14F2N2O |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 4-fluoro-3-[(5-fluoro-2,3-dihydro-1H-inden-1-yl)amino]benzamide |
| SMILES | NC(=O)c1ccc(F)c(NC2CCc3cc(F)ccc32)c1 |
| InChI | InChI=1S/C16H14F2N2O/c17-11-3-4-12-9(7-11)2-6-14(12)20-15-8-10(16(19)21)1-5-13(15)18/h1,3-5,7-8,14,20H,2,6H2,(H2,19,21) |
| InChIKey | VEECPEULHCNLCB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |