C12H16FN3O — CID 116531124
2-[(5-fluoro-2,3-dihydro-1H-inden-1-yl)amino]ethylurea (PubChem CID 116531124) has the molecular formula C12H16FN3O and a molecular weight of 237.28 g/mol. Its IUPAC name is 2-[(5-fluoro-2,3-dihydro-1H-inden-1-yl)amino]ethylurea.
| Compound Name | 2-[(5-fluoro-2,3-dihydro-1H-inden-1-yl)amino]ethylurea |
|---|---|
| PubChem CID | 116531124 |
| Molecular Formula | C12H16FN3O |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 2-[(5-fluoro-2,3-dihydro-1H-inden-1-yl)amino]ethylurea |
| SMILES | NC(=O)NCCNC1CCc2cc(F)ccc21 |
| InChI | InChI=1S/C12H16FN3O/c13-9-2-3-10-8(7-9)1-4-11(10)15-5-6-16-12(14)17/h2-3,7,11,15H,1,4-6H2,(H3,14,16,17) |
| InChIKey | PNOVLJZQXSHXCP-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|