C17H26FN — CID 116531093
5-fluoro-N-octyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 116531093) has the molecular formula C17H26FN and a molecular weight of 263.40 g/mol. Its IUPAC name is 5-fluoro-N-octyl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 5-fluoro-N-octyl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 116531093 |
| Molecular Formula | C17H26FN |
| Molecular Weight | 263.40 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 5-fluoro-N-octyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | CCCCCCCCNC1CCc2cc(F)ccc21 |
| InChI | InChI=1S/C17H26FN/c1-2-3-4-5-6-7-12-19-17-11-8-14-13-15(18)9-10-16(14)17/h9-10,13,17,19H,2-8,11-12H2,1H3 |
| InChIKey | YHTVWSFIZFPPHF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|